![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 20thCenturyPopulatio..> | 2006-02-10 16:00 | 21K | |
| OV1.1 Review of Func..> | 2006-02-10 16:01 | 38K | |
| OV1.1 Review of Func..> | 2006-02-10 16:01 | 91K | |
| OV1.2 - Transformati..> | 2006-02-10 16:01 | 36K | |
| OV1.2 - Transformati..> | 2006-02-10 16:01 | 71K | |
| OV1.3 Inverse Functi..> | 2006-02-10 16:01 | 36K | |
| OV1.3 Inverse Functi..> | 2006-02-10 16:01 | 75K | |
| OV1.4 Transcendental..> | 2006-02-10 16:01 | 45K | |
| OV1.4 Transcendental..> | 2006-02-10 16:01 | 104K | |
| circles.mw | 2006-02-10 16:00 | 12K | |
| exponentialfunctions.mw | 2006-02-10 16:00 | 31K | |
| inversefunctions.mw | 2006-02-10 16:00 | 10K | |
| logarithmicfunctions.mw | 2006-02-10 16:01 | 32K | |
| transformations.mw | 2006-02-10 16:01 | 41K | |
| trigonometry.mw | 2006-02-10 16:01 | 72K | |