![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| SQ4.1-Minima and Max..> | 2006-02-10 16:01 | 45K | |
| SQ4.1-Minima and Max..> | 2006-02-10 16:01 | 31K | |
| SQ4.2-Mean Value The..> | 2006-02-10 16:01 | 40K | |
| SQ4.2-Mean Value The..> | 2006-02-10 16:01 | 30K | |
| SQ4.3-Derivatives an..> | 2006-02-10 16:01 | 45K | |
| SQ4.3-Derivatives an..> | 2006-02-10 16:01 | 32K | |
| SQ4.4-Indeterminate ..> | 2006-02-10 16:01 | 88K | |
| SQ4.4-Indeterminate ..> | 2006-02-10 16:01 | 37K | |
| SQ4.5-Curve Sketchin..> | 2006-02-10 16:01 | 44K | |
| SQ4.5-Curve Sketchin..> | 2006-02-10 16:01 | 41K | |
| concavity.mw | 2006-02-10 16:01 | 29K | |
| extremeValues.mw | 2006-02-10 16:01 | 38K | |
| meanValueTheorem.mw | 2006-02-10 16:01 | 20K | |
| slant asymptote.mw | 2006-02-10 16:01 | 9.9K | |